Cart (0)
No products in the cart.
Purchase CAS:18614-51-2 | 4-Amino-2-fluoropyridine,view related peer-reviewed papers,technical documents,similar products,MSDS & more.4-Amino-2-fluoropyridine is a compound of interest in the field of chemistry due to its potential applications in pharmaceuticals and material science. It is a fluorinated pyridine derivative, which means it contains a pyridine ring—a six-membered aromatic ring with one nitrogen atom—substituted wit...
4-Amino-2-fluoropyridine is a compound of interest in the field of chemistry due to its potential applications in pharmaceuticals and material science. It is a fluorinated pyridine derivative, which means it contains a pyridine ring—a six-membered aromatic ring with one nitrogen atom—substituted with a fluorine atom and an amino group at specific positions. The presence of fluorine is particularly noteworthy as it can significantly alter the physical, chemical, and biological properties of organic compounds, making them valuable in drug design and development.
The synthesis of fluorinated pyridines, including 4-amino-2-fluoropyridine, has been a subject of various studies. One approach to synthesizing related fluorinated azaheterocycles involves the regioselective bromofluorination of N-Boc-protected methylenepiperidine and methylenepyrrolidine. Another method for synthesizing 2-aminopyridine derivatives, which could be adapted for 4-amino-2-fluoropyridine, uses nucleophilic substitution and hydrolysis of 2-fluoropyridine and acetamidine hydrochloride under catalyst-free conditions. Additionally, a novel pathway for 4-fluoropyridines has been reported, which could potentially be applied to the synthesis of 4-amino-2-fluoropyridine, involving Ireland-Claisen and aza-Cope rearrangements.
The molecular structure of 4-amino-2-fluoropyridine and its derivatives has been explored in several studies. For instance, the reaction of 4-amino-2-fluoropyridine with copper halides has led to the formation of neutral coordination complexes with interesting geometries and magnetic properties. These complexes have been characterized by X-ray crystallography, revealing distorted square planar and tetrahedral geometries.
4-Amino-2-fluoropyridine can participate in various chemical reactions due to its reactive amino group and the electron-withdrawing effect of the fluorine atom. The fluorine atom can activate the pyridine ring towards nucleophilic substitution reactions, as demonstrated in the selective fluorination of 4-substituted 2-aminopyridines. Moreover, the amino group can be involved in the formation of coordination complexes, as seen in the synthesis of copper(II) halide complexes.
The physical and chemical properties of 4-amino-2-fluoropyridine are influenced by the presence of the amino and fluorine substituents. The fluorine atom is highly electronegative, which can affect the acidity, basicity, and hydrogen bonding capabilities of the molecule. The amino group can act as a hydrogen bond donor or acceptor, which can impact the solubility and reactivity of the compound. The synthesis of related fluorinated compounds, such as 3-[18F]fluoro-4-aminopyridine, has been investigated for use in PET imaging, indicating the importance of understanding the physical and chemical properties of these molecules.
4-Amino-2-fluoropyridine may cause respiratory irritation, is harmful if swallowed, causes skin irritation, and causes serious eye irritation. It is recommended to handle it in a well-ventilated place, wear suitable protective clothing, and avoid contact with skin and eyes.
Fluoropyridines, including 4-Amino-2-fluoropyridine, are of increasing interest due to their interesting and unusual physical, chemical, and biological properties. They are being explored for use in various biological applications, including as potential imaging agents.
Product Name: | 4-Amino-2-fluoropyridine |
Synonyms: | 4-AMINO-2-FLUOROPYRIDINE;2-FLUORO-PYRIDIN-4-YLAMINE;4-Amino-2-fluoropyridine97%;2-Fluoropyridin-4-amine;4-AMino-2-fluoropyridine 96%;2-fluoro-4-aminopyridine;4-Pyridinamine, 2-fluoro-;4-Amino-2-fluoropyridine ISO 9001:2015 REACH |
CAS: | 18614-51-2 |
MF: | C5H5FN2 |
MW: | 112.11 |
EINECS: | |
Product Categories: | Fluorine series;Pyridines;Pyridine |
Mol File: | 18614-51-2.mol |
4-Amino-2-fluoropyridine Chemical Properties |
Melting point | 83-88°C |
Boiling point | 264.0±20.0 °C(Predicted) |
density | 1.257±0.06 g/cm3(Predicted) |
storage temp. | 2-8°C |
form | solid |
pka | 3.76±0.30(Predicted) |
color | Pale yellow |
InChI | InChI=1S/C5H5FN2/c6-5-3-4(7)1-2-8-5/h1-3H,(H2,7,8) |
InChIKey | JSAKBYXSHKYFQU-UHFFFAOYSA-N |
SMILES | C1(F)=NC=CC(N)=C1 |
CAS DataBase Reference | 18614-51-2(CAS DataBase Reference) |