Cart (0)
No products in the cart.
Purchase CAS:399-72-4 | 5-Fluoro-2-methylindole,view related peer-reviewed papers,technical documents,similar products,MSDS & more.5-Fluoro-2-methylindole is a fluorinated indole derivative, a class of compounds known for their presence in various biological systems and potential therapeutic applications. The presence of the fluorine atom at the 5-position on the indole ring can significantly alter the chemical and physical pro...
5-Fluoro-2-methylindole is a fluorinated indole derivative, a class of compounds known for their presence in various biological systems and potential therapeutic applications. The presence of the fluorine atom at the 5-position on the indole ring can significantly alter the chemical and physical properties of the molecule, potentially leading to unique biological activities.
The synthesis of 5-fluoroindole derivatives has been explored in various studies. For instance, 5-fluoroindole was prepared from m-fluorotoluene in a multi-step process with a 46% overall yield, demonstrating the feasibility of synthesizing such compounds. Additionally, environmentally friendly methods have been employed using heterogeneous catalysts for the synthesis of 5-fluoroindoline-2,3-diones, highlighting the advancement in synthetic methodologies for these compounds.
The molecular structure of 5-fluoroindole has been studied using rotationally resolved spectroscopy, revealing the structure and electronic properties of the ground state and the lowest excited singlet state. The character of the excited state was identified as L(b), which provides insights into the photophysical behavior of the molecule.
5-Fluoroindole derivatives have been shown to participate in various chemical reactions. For example, 5-fluoroindole-3-acetic acid is oxidized by horseradish peroxidase, forming cytotoxic products that suggest potential for targeted cancer therapy. Furthermore, the reactivity of 5-fluoroindole with different reagents has been explored, such as the formation of a covalent complex with thymidylate synthetase, which is significant in the context of biochemical pathways.
The physical and chemical properties of 5-fluoroindole derivatives are influenced by the presence of the fluorine atom. The fluorine substitution can affect the molecule's acidity, basicity, and overall reactivity. For instance, the oxidation chemistry of 5,6-dihydroxy-2-methylindole has been studied, showing rapid oxidation by the peroxidase/H2O2 system to yield a complex mixture of oligomers. Additionally, the synthesis and reactions of 2-pentafluorophenyl-5-/6-fluoroindoles have been reported, which further contributes to the understanding of the chemical behavior of fluorinated indoles.
5-Fluoro-2-methylindole is considered hazardous by the 2012 OSHA Hazard Communication Standard (29 CFR 1910.1200). It can cause skin irritation, serious eye irritation, and may cause respiratory irritation. Safety measures include washing face, hands, and any exposed skin thoroughly after handling, wearing protective gloves/clothing/eye protection/face protection, and using only outdoors or in a well-ventilated area.
Product Name: | 5-Fluoro-2-methylindole |
Synonyms: | 5-FLUORO-2-METHYL-1H-INDOLE;5-FLUORO-2-METHYLINDOLE;1H-Indole, 5-fluoro-2-methyl-;5-Fluoro-2-methyl-1H-indole 97% |
CAS: | 399-72-4 |
MF: | C9H8FN |
MW: | 149.16 |
EINECS: | 609-764-5 |
Product Categories: | Heterocycles series;Pyrroles & Indoles;Indole;Pyrroles & Indoles;Building Blocks;Heterocyclic Building Blocks;Indoles |
Mol File: | 399-72-4.mol |
5-Fluoro-2-methylindole Chemical Properties |
Melting point | 98-101 °C (lit.) |
Boiling point | 112-120C |
density | 1.219±0.06 g/cm3(Predicted) |
storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
form | Solid |
pka | 16.73±0.30(Predicted) |
color | Light yellow to Brown |
InChI | InChI=1S/C9H8FN/c1-6-4-7-5-8(10)2-3-9(7)11-6/h2-5,11H,1H3 |
InChIKey | JJIUISYYTFDATN-UHFFFAOYSA-N |
SMILES | N1C2=C(C=C(F)C=C2)C=C1C |
CAS DataBase Reference | 399-72-4(CAS DataBase Reference) |